Products 403479-18-5

CAS 403479-18-5 is the registry number for tert-Butyl (1r,3r,5s)-8-azabicyclo[3.2.1]octan-3-ylcarbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(8-azabicyclo[3.2.1]octan-3-yl)carbamate;hydrochloride (CAS 403479-18-5) is a chemical compound with the molecular formula C12H23ClN2O2 and a molecular weight of 262.77 g/mol. IUPAC name: tert-butyl N-(8-azabicyclo[3.2.1]octan-3-yl)carbamate;hydrochloride. InChIKey: FAJOKGXZZTZLAU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23ClN2O2
Molecular weight262.77 g/mol
IUPAC nametert-butyl N-(8-azabicyclo[3.2.1]octan-3-yl)carbamate;hydrochloride
InChIKeyFAJOKGXZZTZLAU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CC2CCC(C1)N2.Cl

Computed by PubChem (NCBI)