CAS 1279844-25-5 appears in our catalog under these names: tert-Butyl 2,6-diazaspiro[3.5]nonane-6-carboxylate hydrochloride, 95%, tert–Butyl 2,6–diazaspiro(3·5)nonane–6–carboxylate hydrochloride, tert-Butyl 2,6-diazaspiro(3.5)nonane-6-carboxylate hydrochloride, tert-Butyl 2,6-diazaspiro[3.5]nonane-6-carboxylate hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 2,5g, 5g.
Tert-butyl 2,6-diazaspiro[3.5]nonane-6-carboxylate;hydrochloride (CAS 1279844-25-5) is a chemical compound with the molecular formula C12H23ClN2O2 and a molecular weight of 262.77 g/mol. IUPAC name: tert-butyl 2,6-diazaspiro[3.5]nonane-6-carboxylate;hydrochloride. InChIKey: RFVCOWNSSOSDJH-UHFFFAOYSA-N.
| Molecular formula | C12H23ClN2O2 |
|---|---|
| Molecular weight | 262.77 g/mol |
| IUPAC name | tert-butyl 2,6-diazaspiro[3.5]nonane-6-carboxylate;hydrochloride |
| InChIKey | RFVCOWNSSOSDJH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CNC2.Cl |
Computed by PubChem (NCBI)