cas: 196085-85-5 — see every product listed under this CAS number, including other names
tert-Butyl 2-((4S,6S)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl)acetate 95% (CAS 196085-85-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A257704-25mg |
| cas | 196085-85-5 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 1360.50 Pln | |
| Ambeed | 50mg | 2111.44 Pln | |
| Ambeed | 100mg | 3346.31 Pln | |
| Ambeed | 250mg | 6622.62 Pln | |
| Ambeed | 1g | 16451.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A257704 |
Tert-butyl 2-[(4S,6S)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 196085-85-5) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: tert-butyl 2-[(4S,6S)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: DPNRMEJBKMQHMC-QWRGUYRKSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | tert-butyl 2-[(4S,6S)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | DPNRMEJBKMQHMC-QWRGUYRKSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)CC(=O)OC(C)(C)C)CC#N)C |
Computed by PubChem (NCBI)