CAS 196085-85-5 appears in our catalog under these names: Atorvastatin Impurity 18, (4S,6S)-6-(Cyanomethyl)-2,2-dimethyl-1,3-dioxane-4-acetic acid tert-butyl ester, tert-Butyl 2-((4S,6S)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl)acetate 95%, tert-Butyl 2-((4S,6S)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl)acetate, 95%, 95%. Offered by: Chemat Brand, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 25mg, 10mg, 50mg, 100mg, 250mg, 1g.
Tert-butyl 2-[(4S,6S)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 196085-85-5) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: tert-butyl 2-[(4S,6S)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: DPNRMEJBKMQHMC-QWRGUYRKSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | tert-butyl 2-[(4S,6S)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | DPNRMEJBKMQHMC-QWRGUYRKSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)CC(=O)OC(C)(C)C)CC#N)C |
Computed by PubChem (NCBI)