cas: 1823872-01-0 — see every product listed under this CAS number, including other names
tert-Butyl 2-amino-4-formylthiazole-3(2h)-carboxylate, 95% (CAS 1823872-01-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg. Offered by: Combi-blocks, AmBeed, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | HD-0279-1g |
| cas | 1823872-01-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| AmBeed | 1g | 1196.23 Pln | |
| AmBeed | 10g | 5147.80 Pln | |
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 414.46 Pln | |
| Fluorochem | 5g | 1637.98 Pln | |
| Fluorochem | 10g | 3012.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Tert-butyl 2-amino-4-formyl-2H-1,3-thiazole-3-carboxylate (CAS 1823872-01-0) is a chemical compound with the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. IUPAC name: tert-butyl 2-amino-4-formyl-2H-1,3-thiazole-3-carboxylate. InChIKey: SUJBWQJKURLRPJ-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3S |
|---|---|
| Molecular weight | 230.29 g/mol |
| IUPAC name | tert-butyl 2-amino-4-formyl-2H-1,3-thiazole-3-carboxylate |
| InChIKey | SUJBWQJKURLRPJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(SC=C1C=O)N |
Computed by PubChem (NCBI)