cas: 957063-12-6 — see every product listed under this CAS number, including other names
tert-Butyl 2-bromo-5-methoxybenzoate, 95%, 95% (CAS 957063-12-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UJB-100mg |
| cas | 957063-12-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 957.20 Pln | |
| Chemat | 5g | 2819.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-bromo-5-methoxybenzoate (CAS 957063-12-6) is a chemical compound with the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. IUPAC name: tert-butyl 2-bromo-5-methoxybenzoate. InChIKey: JNNMFVKQTXPGQD-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO3 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | tert-butyl 2-bromo-5-methoxybenzoate |
| InChIKey | JNNMFVKQTXPGQD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=C1)OC)Br |
Computed by PubChem (NCBI)