cas: 301226-27-7 — see every product listed under this CAS number, including other names
tert-Butyl 2-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate 98% (CAS 301226-27-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A647493-100mg |
| cas | 301226-27-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1405.00 Pln | |
| Ambeed | 10g | 2556.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A647493 |
Tert-butyl 2-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate (CAS 301226-27-7) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: tert-butyl 2-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate. InChIKey: DXCDANAWBPYOAA-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | tert-butyl 2-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| InChIKey | DXCDANAWBPYOAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(=O)O2)CC1 |
Computed by PubChem (NCBI)