cas: 347195-73-7 — see every product listed under this CAS number, including other names
tert-Butyl 3,8-diazabicyclo[3.2.1]octane-8-carboxylate hydrochloride(1:x), 98%, 98% (CAS 347195-73-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CLTU-50mg |
| cas | 347195-73-7 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 136.40 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 678.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3,8-diazabicyclo[3.2.1]octane-8-carboxylate;hydrochloride (CAS 347195-73-7) is a chemical compound with the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. IUPAC name: tert-butyl 3,8-diazabicyclo[3.2.1]octane-8-carboxylate;hydrochloride. InChIKey: PEFVMMCFCHFPIN-UHFFFAOYSA-N.
| Molecular formula | C11H21ClN2O2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | tert-butyl 3,8-diazabicyclo[3.2.1]octane-8-carboxylate;hydrochloride |
| InChIKey | PEFVMMCFCHFPIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CNC2.Cl |
Computed by PubChem (NCBI)