cas: 1235036-15-3 — see every product listed under this CAS number, including other names
tert-Butyl 3-bromo-6-chloropicolinate 97% (CAS 1235036-15-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A146851-100mg |
| cas | 1235036-15-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 431.56 Pln | |
| Ambeed | 25g | 1488.44 Pln | |
| Ambeed | 100g | 5738.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A146851 |
Tert-butyl 3-bromo-6-chloropyridine-2-carboxylate (CAS 1235036-15-3) is a chemical compound with the molecular formula C10H11BrClNO2 and a molecular weight of 292.55 g/mol. IUPAC name: tert-butyl 3-bromo-6-chloropyridine-2-carboxylate. InChIKey: JKGXLKXQUDHRLL-UHFFFAOYSA-N.
| Molecular formula | C10H11BrClNO2 |
|---|---|
| Molecular weight | 292.55 g/mol |
| IUPAC name | tert-butyl 3-bromo-6-chloropyridine-2-carboxylate |
| InChIKey | JKGXLKXQUDHRLL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=N1)Cl)Br |
Computed by PubChem (NCBI)