cas: 1208864-35-0 — see every product listed under this CAS number, including other names
tert-Butyl 3-fluoro-4,4-dihydroxypiperidine-1-carboxylate, 97% (CAS 1208864-35-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 100g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A772523-10g |
| cas | 1208864-35-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 460.60 Pln | |
| AmBeed | 1g | 239.26 Pln | |
| AmBeed | 5g | 291.34 Pln | |
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 10g | 456.11 Pln | |
| Fluorochem | 25g | 914.28 Pln | |
| Fluorochem | 100g | 2517.88 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 3-fluoro-4,4-dihydroxypiperidine-1-carboxylate (CAS 1208864-35-0) is a chemical compound with the molecular formula C10H18FNO4 and a molecular weight of 235.25 g/mol. IUPAC name: tert-butyl 3-fluoro-4,4-dihydroxypiperidine-1-carboxylate. InChIKey: XFGJBCDWYNSTJT-UHFFFAOYSA-N.
| Molecular formula | C10H18FNO4 |
|---|---|
| Molecular weight | 235.25 g/mol |
| IUPAC name | tert-butyl 3-fluoro-4,4-dihydroxypiperidine-1-carboxylate |
| InChIKey | XFGJBCDWYNSTJT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)F)(O)O |
Computed by PubChem (NCBI)