cas: 1208864-35-0 — see every product listed under this CAS number, including other names
tert-butyl 3-fluoro-4,4-dihydroxypiperidine-1-carboxylate, 97%, 97% (CAS 1208864-35-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HFSW-5g |
| cas | 1208864-35-0 |
| size | 5g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 194.00 Pln | |
| Chemat | 10g | 294.80 Pln | |
| Chemat | 25g | 568.40 Pln | |
| Chemat | 100g | 1538.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-fluoro-4,4-dihydroxypiperidine-1-carboxylate (CAS 1208864-35-0) is a chemical compound with the molecular formula C10H18FNO4 and a molecular weight of 235.25 g/mol. IUPAC name: tert-butyl 3-fluoro-4,4-dihydroxypiperidine-1-carboxylate. InChIKey: XFGJBCDWYNSTJT-UHFFFAOYSA-N.
| Molecular formula | C10H18FNO4 |
|---|---|
| Molecular weight | 235.25 g/mol |
| IUPAC name | tert-butyl 3-fluoro-4,4-dihydroxypiperidine-1-carboxylate |
| InChIKey | XFGJBCDWYNSTJT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)F)(O)O |
Computed by PubChem (NCBI)