cas: 1395493-25-0 — see every product listed under this CAS number, including other names
tert-Butyl 3-oxo-5,7-dihydro-2H-pyrrolo[3,4-c]pyridazine-6(3H)-carboxylate 95% (CAS 1395493-25-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A363280-100mg |
| cas | 1395493-25-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 770.88 Pln | |
| Ambeed | 250mg | 1271.50 Pln | |
| Ambeed | 1g | 2990.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A363280 |
Tert-butyl 3-oxo-5,7-dihydro-2H-pyrrolo[3,4-c]pyridazine-6-carboxylate (CAS 1395493-25-0) is a chemical compound with the molecular formula C11H15N3O3 and a molecular weight of 237.25 g/mol. IUPAC name: tert-butyl 3-oxo-5,7-dihydro-2H-pyrrolo[3,4-c]pyridazine-6-carboxylate. InChIKey: MLTOJIPVKVSXEM-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O3 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | tert-butyl 3-oxo-5,7-dihydro-2H-pyrrolo[3,4-c]pyridazine-6-carboxylate |
| InChIKey | MLTOJIPVKVSXEM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=CC(=O)NN=C2C1 |
Computed by PubChem (NCBI)