cas: 1280210-79-8 — see every product listed under this CAS number, including other names
tert-Butyl 4,6-dihydropyrrolo[3,4-c]pyrazole-5(2H)-carboxylate, 97% (CAS 1280210-79-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 100mg, 250mg, 500g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F496801-1G |
| cas | 1280210-79-8 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 148.92 Pln | |
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 497.76 Pln | |
| Fluorochem | 25g | 830.98 Pln | |
| Fluorochem | 100g | 2799.03 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 809.81 Pln | |
| Ambeed | 100g | 2717.75 Pln | |
| Ambeed | 500g | 10655.44 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Tert-butyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate (CAS 1280210-79-8) is a chemical compound with the molecular formula C10H15N3O2 and a molecular weight of 209.24 g/mol. IUPAC name: tert-butyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate. InChIKey: IBUNCTVDGYIKAP-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | tert-butyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate |
| InChIKey | IBUNCTVDGYIKAP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)NN=C2 |
Computed by PubChem (NCBI)