cas: 1280210-79-8 — see every product listed under this CAS number, including other names
tert-Butyl 4,6-dihydropyrrolo[3,4-c]pyrazole-5(2H)-carboxylate, 97%, 97% (CAS 1280210-79-8) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111XPC-1kg |
| cas | 1280210-79-8 |
| size | 1kg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 6818.00 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 10g | 290.00 Pln | |
| Chemat | 25g | 611.60 Pln | |
| Chemat | 50g | 1029.20 Pln | |
| Chemat | 100g | 1782.80 Pln | |
| Chemat | 250g | 4024.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate (CAS 1280210-79-8) is a chemical compound with the molecular formula C10H15N3O2 and a molecular weight of 209.24 g/mol. IUPAC name: tert-butyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate. InChIKey: IBUNCTVDGYIKAP-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | tert-butyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate |
| InChIKey | IBUNCTVDGYIKAP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)NN=C2 |
Computed by PubChem (NCBI)