CAS 1462383-16-9 appears in our catalog under these names: Risdiplam Impurity 9 HCl, tert-Butyl 4,7-diazaspiro[2.5]octane-7-carboxylate hydrochloride, 95%, tert-Butyl 4,7-diazaspiro[2.5]octane-7-carboxylate hydrochloride, 98%, 98%, tert-Butyl 4,7-diazaspiro[2.5]octane-7-carboxylate hydrochloride, 98%. Offered by: Chemat Brand, Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: on request, 250mg, 1g, 100mg, 5g.
Tert-butyl 4,7-diazaspiro[2.5]octane-7-carboxylate;hydrochloride (CAS 1462383-16-9) is a chemical compound with the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. IUPAC name: tert-butyl 4,7-diazaspiro[2.5]octane-7-carboxylate;hydrochloride. InChIKey: BTGINIPKPAJNCY-UHFFFAOYSA-N.
| Molecular formula | C11H21ClN2O2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | tert-butyl 4,7-diazaspiro[2.5]octane-7-carboxylate;hydrochloride |
| InChIKey | BTGINIPKPAJNCY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC2(C1)CC2.Cl |
Computed by PubChem (NCBI)