cas: 161975-39-9 — see every product listed under this CAS number, including other names
tert-Butyl 4-(((methylsulfonyl)oxy)methyl)piperidine-1-carboxylate, 95%, 95% (CAS 161975-39-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AOTR-250mg |
| cas | 161975-39-9 |
| size | 250mg |
| availability | 749.75g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 232.40 Pln | |
| Chemat | 50g | 390.80 Pln | |
| Chemat | 100g | 635.60 Pln | |
| Chemat | 250g | 1370.00 Pln | |
| Chemat | 500g | 2294.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(methylsulfonyloxymethyl)piperidine-1-carboxylate (CAS 161975-39-9) is a chemical compound with the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. IUPAC name: tert-butyl 4-(methylsulfonyloxymethyl)piperidine-1-carboxylate. InChIKey: RXNQBVRCZIYUJK-UHFFFAOYSA-N.
| Molecular formula | C12H23NO5S |
|---|---|
| Molecular weight | 293.38 g/mol |
| IUPAC name | tert-butyl 4-(methylsulfonyloxymethyl)piperidine-1-carboxylate |
| InChIKey | RXNQBVRCZIYUJK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)COS(=O)(=O)C |
Computed by PubChem (NCBI)