cas: 170017-73-9 — see every product listed under this CAS number, including other names
tert-Butyl 4-(2-nitrophenyl)piperazine-1-carboxylate, ≥97-<99% (CAS 170017-73-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1515-97-99-25g |
| cas | 170017-73-9 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 4620.88 Pln | |
| Hoffman Fine Chemicals | 50g | 7198.40 Pln | |
| Hoffman Fine Chemicals | 100g | 11339.02 Pln | |
| Hoffman Fine Chemicals | 200g | 17955.08 Pln | |
| Hoffman Fine Chemicals | 300g | 21489.60 Pln | |
| Hoffman Fine Chemicals | 400g | 24322.32 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Tert-butyl 4-(2-nitrophenyl)piperazine-1-carboxylate (CAS 170017-73-9) is a chemical compound with the molecular formula C15H21N3O4 and a molecular weight of 307.34 g/mol. IUPAC name: tert-butyl 4-(2-nitrophenyl)piperazine-1-carboxylate. InChIKey: GTGIZVUOLBRDAO-UHFFFAOYSA-N.
| Molecular formula | C15H21N3O4 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | tert-butyl 4-(2-nitrophenyl)piperazine-1-carboxylate |
| InChIKey | GTGIZVUOLBRDAO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)