cas: 327030-39-7 — see every product listed under this CAS number, including other names
tert-Butyl 4-(3-bromophenyl)piperazine-1-carboxylate, 95% (CAS 327030-39-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218696-1G |
| cas | 327030-39-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 529.00 Pln | |
| Fluorochem | 10g | 997.58 Pln | |
| Fluorochem | 25g | 1627.57 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 4-(3-bromophenyl)piperazine-1-carboxylate (CAS 327030-39-7) is a chemical compound with the molecular formula C15H21BrN2O2 and a molecular weight of 341.24 g/mol. IUPAC name: tert-butyl 4-(3-bromophenyl)piperazine-1-carboxylate. InChIKey: DVJZPRQEOHFPQO-UHFFFAOYSA-N.
| Molecular formula | C15H21BrN2O2 |
|---|---|
| Molecular weight | 341.24 g/mol |
| IUPAC name | tert-butyl 4-(3-bromophenyl)piperazine-1-carboxylate |
| InChIKey | DVJZPRQEOHFPQO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)