cas: 203047-33-0 — see every product listed under this CAS number, including other names
tert-Butyl 4-(3-nitrobenzyl)piperazine-1-carboxylate, >97%, >97% (CAS 203047-33-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114E2I-1g |
| cas | 203047-33-0 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 434.00 Pln | |
| Chemat | 5g | 1038.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-[(3-nitrophenyl)methyl]piperazine-1-carboxylate (CAS 203047-33-0) is a chemical compound with the molecular formula C16H23N3O4 and a molecular weight of 321.37 g/mol. IUPAC name: tert-butyl 4-[(3-nitrophenyl)methyl]piperazine-1-carboxylate. InChIKey: HWTWAJBOXCYPAM-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O4 |
|---|---|
| Molecular weight | 321.37 g/mol |
| IUPAC name | tert-butyl 4-[(3-nitrophenyl)methyl]piperazine-1-carboxylate |
| InChIKey | HWTWAJBOXCYPAM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)