cas: 850568-72-8 — see every product listed under this CAS number, including other names
tert-Butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate 97% (CAS 850568-72-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A277848-250mg |
| cas | 850568-72-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 353.69 Pln | |
| Ambeed | 100g | 1093.50 Pln | |
| Ambeed | 500g | 5109.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A277848 |
Tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 850568-72-8) is a chemical compound with the molecular formula C17H25BO4 and a molecular weight of 304.2 g/mol. IUPAC name: tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: GNXLDEFJAZGNCJ-UHFFFAOYSA-N.
| Molecular formula | C17H25BO4 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | GNXLDEFJAZGNCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)