cas: 850568-72-8 — see every product listed under this CAS number, including other names
tert-Butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98% (CAS 850568-72-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F231985-1G |
| cas | 850568-72-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 190.58 Pln | |
| Fluorochem | 25g | 341.56 Pln | |
| Fluorochem | 100g | 1080.89 Pln | |
| Fluorochem | 500g | 4163.14 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 850568-72-8) is a chemical compound with the molecular formula C17H25BO4 and a molecular weight of 304.2 g/mol. IUPAC name: tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: GNXLDEFJAZGNCJ-UHFFFAOYSA-N.
| Molecular formula | C17H25BO4 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | GNXLDEFJAZGNCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)