cas: 850568-72-8 — see every product listed under this CAS number, including other names
tert-Butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 97%, 97% (CAS 850568-72-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KAF-250mg |
| cas | 850568-72-8 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 256.40 Pln | |
| Chemat | 50g | 448.40 Pln | |
| Chemat | 100g | 813.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 850568-72-8) is a chemical compound with the molecular formula C17H25BO4 and a molecular weight of 304.2 g/mol. IUPAC name: tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: GNXLDEFJAZGNCJ-UHFFFAOYSA-N.
| Molecular formula | C17H25BO4 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | GNXLDEFJAZGNCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)