tert-Butyl 4-(4-(hydroxymethyl)piperidin-1-yl)benzoate, 95%
cas: 2222116-06-3 — see every product listed under this CAS number, including other names
tert-Butyl 4-(4-(hydroxymethyl)piperidin-1-yl)benzoate, 95% (CAS 2222116-06-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A2728344-50mg |
| cas | 2222116-06-3 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 581.75 Pln | |
| Ambeed | 100mg | 921.06 Pln | |
| Ambeed | 250mg | 1900.06 Pln | |
| Ambeed | 1g | 4731.38 Pln | |
| BLDpharm | 50mg | 625.36 Pln | |
| BLDpharm | 100mg | 986.34 Pln | |
| BLDpharm | 250mg | 2041.53 Pln | |
| BLDpharm | 1g | 5096.01 Pln | |
| Chemat | 50mg | 429.20 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 1365.20 Pln | |
| Chemat | 1g | 3376.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 4-[4-(hydroxymethyl)piperidin-1-yl]benzoate (CAS 2222116-06-3) is a chemical compound with the molecular formula C17H25NO3 and a molecular weight of 291.4 g/mol. IUPAC name: tert-butyl 4-[4-(hydroxymethyl)piperidin-1-yl]benzoate. InChIKey: KOLFROKCTDISHC-UHFFFAOYSA-N.
| Molecular formula | C17H25NO3 |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | tert-butyl 4-[4-(hydroxymethyl)piperidin-1-yl]benzoate |
| InChIKey | KOLFROKCTDISHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)N2CCC(CC2)CO |
Computed by PubChem (NCBI)