CAS 632353-21-0 is the registry number for Cis-Tert-Butyl 3-Benzyl-4-Hydroxypiperidine-1-Carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl (3S,4R)-3-benzyl-4-hydroxypiperidine-1-carboxylate (CAS 632353-21-0) is a chemical compound with the molecular formula C17H25NO3 and a molecular weight of 291.4 g/mol. IUPAC name: tert-butyl (3S,4R)-3-benzyl-4-hydroxypiperidine-1-carboxylate. InChIKey: URJKJIHCHLRYJJ-LSDHHAIUSA-N.
| Molecular formula | C17H25NO3 |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3-benzyl-4-hydroxypiperidine-1-carboxylate |
| InChIKey | URJKJIHCHLRYJJ-LSDHHAIUSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)CC2=CC=CC=C2)O |
Computed by PubChem (NCBI)