CAS 930585-94-7 appears in our catalog under these names: Pregabalin Impurity 79, (3R)-5-Methyl-3-(2-oxo-2-(((1R)-1-phenylethyl)amino)ethyl)hexanoic Acid, (R)-5-Methyl-3-(2-oxo-2-(((R)-1-phenylethyl)amino)ethyl)hexanoic acid 98%. Offered by: Chemat Brand, TRC, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g.
(3R)-5-methyl-3-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]hexanoic acid (CAS 930585-94-7) is a chemical compound with the molecular formula C17H25NO3 and a molecular weight of 291.4 g/mol. IUPAC name: (3R)-5-methyl-3-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]hexanoic acid. InChIKey: MNEMQQWDPAVARE-ZIAGYGMSSA-N.
| Molecular formula | C17H25NO3 |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | (3R)-5-methyl-3-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]hexanoic acid |
| InChIKey | MNEMQQWDPAVARE-ZIAGYGMSSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NC(=O)C[C@@H](CC(C)C)CC(=O)O |
Computed by PubChem (NCBI)