CAS 1445951-69-8 is the registry number for tert-Butyl (3S,4S)-3-benzyl-4-hydroxypiperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl (3S,4S)-3-benzyl-4-hydroxypiperidine-1-carboxylate (CAS 1445951-69-8) is a chemical compound with the molecular formula C17H25NO3 and a molecular weight of 291.4 g/mol. IUPAC name: tert-butyl (3S,4S)-3-benzyl-4-hydroxypiperidine-1-carboxylate. InChIKey: URJKJIHCHLRYJJ-GJZGRUSLSA-N.
| Molecular formula | C17H25NO3 |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | tert-butyl (3S,4S)-3-benzyl-4-hydroxypiperidine-1-carboxylate |
| InChIKey | URJKJIHCHLRYJJ-GJZGRUSLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@H](C1)CC2=CC=CC=C2)O |
Computed by PubChem (NCBI)