cas: 333954-86-2 — see every product listed under this CAS number, including other names
tert-Butyl 4-(4-cyanophenoxy)piperidine-1-carboxylate 95% (CAS 333954-86-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A299346-5g |
| cas | 333954-86-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 1215.88 Pln | |
| Ambeed | 10g | 1977.94 Pln | |
| Ambeed | 25g | 3719.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A299346 |
Tert-butyl 4-(4-cyanophenoxy)piperidine-1-carboxylate (CAS 333954-86-2) is a chemical compound with the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. IUPAC name: tert-butyl 4-(4-cyanophenoxy)piperidine-1-carboxylate. InChIKey: ODHVBWQNZTWKCV-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O3 |
|---|---|
| Molecular weight | 302.37 g/mol |
| IUPAC name | tert-butyl 4-(4-cyanophenoxy)piperidine-1-carboxylate |
| InChIKey | ODHVBWQNZTWKCV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)OC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)