cas: 374930-88-8 — see every product listed under this CAS number, including other names
tert-Butyl 4-(5-bromopyrimidin-2-yl)piperazine-1-carboxylate 98% (CAS 374930-88-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A877764-250mg |
| cas | 374930-88-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 553.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A877764 |
Tert-butyl 4-(5-bromopyrimidin-2-yl)piperazine-1-carboxylate (CAS 374930-88-8) is a chemical compound with the molecular formula C13H19BrN4O2 and a molecular weight of 343.22 g/mol. IUPAC name: tert-butyl 4-(5-bromopyrimidin-2-yl)piperazine-1-carboxylate. InChIKey: UKCBGXCNXOKVTF-UHFFFAOYSA-N.
| Molecular formula | C13H19BrN4O2 |
|---|---|
| Molecular weight | 343.22 g/mol |
| IUPAC name | tert-butyl 4-(5-bromopyrimidin-2-yl)piperazine-1-carboxylate |
| InChIKey | UKCBGXCNXOKVTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)