cas: 1266118-78-8 — see every product listed under this CAS number, including other names
tert-Butyl 4-(6-chloropyridin-2-yl)piperidine-1-carboxylate, 98% (CAS 1266118-78-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F761534-1G |
| cas | 1266118-78-8 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 211.40 Pln | |
| Fluorochem | 5g | 544.62 Pln | |
| Fluorochem | 10g | 1023.62 Pln | |
| Fluorochem | 25g | 1762.94 Pln | |
| Fluorochem | 50g | 3179.11 Pln | |
| Fluorochem | 100g | 4553.62 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 25g | 1744.31 Pln | |
| Ambeed | 100g | 6750.56 Pln | |
| Ambeed | 500g | 26803.38 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Tert-butyl 4-(6-chloro-2-pyridinyl)piperidine-1-carboxylate (CAS 1266118-78-8) is a chemical compound with the molecular formula C15H21ClN2O2 and a molecular weight of 296.79 g/mol. IUPAC name: tert-butyl 4-(6-chloro-2-pyridinyl)piperidine-1-carboxylate. InChIKey: YAWLZFBIZMMVLI-UHFFFAOYSA-N.
| Molecular formula | C15H21ClN2O2 |
|---|---|
| Molecular weight | 296.79 g/mol |
| IUPAC name | tert-butyl 4-(6-chloro-2-pyridinyl)piperidine-1-carboxylate |
| InChIKey | YAWLZFBIZMMVLI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=NC(=CC=C2)Cl |
Computed by PubChem (NCBI)