cas: 868171-70-4 — see every product listed under this CAS number, including other names
tert-Butyl 4-amino-5-bromopicolinate 96% (CAS 868171-70-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A632851-100mg |
| cas | 868171-70-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 1199.19 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A632851 |
Tert-butyl 4-amino-5-bromopyridine-2-carboxylate (CAS 868171-70-4) is a chemical compound with the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. IUPAC name: tert-butyl 4-amino-5-bromopyridine-2-carboxylate. InChIKey: HBOVPYWDRQPVII-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | tert-butyl 4-amino-5-bromopyridine-2-carboxylate |
| InChIKey | HBOVPYWDRQPVII-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NC=C(C(=C1)N)Br |
Computed by PubChem (NCBI)