cas: 1228014-35-4 — see every product listed under this CAS number, including other names
tert-Butyl 4-bromo-1H-pyrrolo[2,3-b]pyridine-1-carboxylate, 96%, 96% (CAS 1228014-35-4) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111JHV-500mg |
| cas | 1228014-35-4 |
| size | 500mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 314.00 Pln | |
| Chemat | 10g | 1763.60 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 1038.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-bromopyrrolo[2,3-b]pyridine-1-carboxylate (CAS 1228014-35-4) is a chemical compound with the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. IUPAC name: tert-butyl 4-bromopyrrolo[2,3-b]pyridine-1-carboxylate. InChIKey: XIWJCGZCLBMYBC-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2 |
|---|---|
| Molecular weight | 297.15 g/mol |
| IUPAC name | tert-butyl 4-bromopyrrolo[2,3-b]pyridine-1-carboxylate |
| InChIKey | XIWJCGZCLBMYBC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C(C=CN=C21)Br |
Computed by PubChem (NCBI)