cas: 247186-51-2 — see every product listed under this CAS number, including other names
tert-Butyl 4-bromo-3-methoxybenzoate, 95%, 95% (CAS 247186-51-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113P7G-100mg |
| cas | 247186-51-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-bromo-3-methoxybenzoate (CAS 247186-51-2) is a chemical compound with the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. IUPAC name: tert-butyl 4-bromo-3-methoxybenzoate. InChIKey: QVCCBRWZXNOFCC-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO3 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | tert-butyl 4-bromo-3-methoxybenzoate |
| InChIKey | QVCCBRWZXNOFCC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1)Br)OC |
Computed by PubChem (NCBI)