cas: 871013-92-2 — see every product listed under this CAS number, including other names
tert-Butyl 4-hydroxyisoindoline-2-carboxylate 97% (CAS 871013-92-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A632005-100mg |
| cas | 871013-92-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 820.94 Pln | |
| Ambeed | 5g | 3802.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A632005 |
Tert-butyl 4-hydroxy-1,3-dihydroisoindole-2-carboxylate (CAS 871013-92-2) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: tert-butyl 4-hydroxy-1,3-dihydroisoindole-2-carboxylate. InChIKey: KAWGDHUTSZFFIP-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | tert-butyl 4-hydroxy-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | KAWGDHUTSZFFIP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)C(=CC=C2)O |
Computed by PubChem (NCBI)