cas: 1434142-28-5 — see every product listed under this CAS number, including other names
tert-Butyl 5-azaspiro(2.4)heptan-1-ylcarbamate hydrochloride, 97% (CAS 1434142-28-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A417540-5g |
| cas | 1434142-28-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 19300.54 Pln | |
| AmBeed | 10g | 32118.73 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-(5-azaspiro[2.4]heptan-2-yl)carbamate;hydrochloride (CAS 1434142-28-5) is a chemical compound with the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. IUPAC name: tert-butyl N-(5-azaspiro[2.4]heptan-2-yl)carbamate;hydrochloride. InChIKey: HPGJJHJYXDCYAU-UHFFFAOYSA-N.
| Molecular formula | C11H21ClN2O2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | tert-butyl N-(5-azaspiro[2.4]heptan-2-yl)carbamate;hydrochloride |
| InChIKey | HPGJJHJYXDCYAU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC12CCNC2.Cl |
Computed by PubChem (NCBI)