cas: 928653-80-9 — see every product listed under this CAS number, including other names
tert-Butyl 5-bromo-1H-pyrrolo[2,3-b]pyridine-1-carboxylate, 97% (CAS 928653-80-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216163-1G |
| cas | 928653-80-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 893.45 Pln | |
| Fluorochem | 10g | 1507.82 Pln | |
| Fluorochem | 25g | 3215.55 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 5-bromopyrrolo[2,3-b]pyridine-1-carboxylate (CAS 928653-80-9) is a chemical compound with the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. IUPAC name: tert-butyl 5-bromopyrrolo[2,3-b]pyridine-1-carboxylate. InChIKey: IEJVSMXKNBLMND-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2 |
|---|---|
| Molecular weight | 297.15 g/mol |
| IUPAC name | tert-butyl 5-bromopyrrolo[2,3-b]pyridine-1-carboxylate |
| InChIKey | IEJVSMXKNBLMND-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=CC(=CN=C21)Br |
Computed by PubChem (NCBI)