cas: 195517-88-5 — see every product listed under this CAS number, including other names
tert-Butyl 5-chloro-2-hydroxybenzylcarbamate, 98% (CAS 195517-88-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 5g, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A979703-100mg |
| cas | 195517-88-5 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 616.84 Pln | |
| AmBeed | 10g | 16572.85 Pln | |
| AmBeed | 5g | 10225.60 Pln | |
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 732.05 Pln | |
| Fluorochem | 1g | 1830.62 Pln | |
| Fluorochem | 5g | 6375.90 Pln | |
| Fluorochem | 10g | 10322.42 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-[(5-chloro-2-hydroxyphenyl)methyl]carbamate (CAS 195517-88-5) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: tert-butyl N-[(5-chloro-2-hydroxyphenyl)methyl]carbamate. InChIKey: IEXNKDQSZTYMTI-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | tert-butyl N-[(5-chloro-2-hydroxyphenyl)methyl]carbamate |
| InChIKey | IEXNKDQSZTYMTI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=C(C=CC(=C1)Cl)O |
Computed by PubChem (NCBI)