cas: 1824073-96-2 — see every product listed under this CAS number, including other names
tert-Butyl 5-methoxyisoindoline-2-carboxylate, 97%, 97% (CAS 1824073-96-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1134UV-100mg |
| cas | 1824073-96-2 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 650.00 Pln | |
| Chemat | 5g | 2541.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 5-methoxy-1,3-dihydroisoindole-2-carboxylate (CAS 1824073-96-2) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: tert-butyl 5-methoxy-1,3-dihydroisoindole-2-carboxylate. InChIKey: RLPRJHLDNXWKQA-UHFFFAOYSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | tert-butyl 5-methoxy-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | RLPRJHLDNXWKQA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)