cas: 630110-71-3 — see every product listed under this CAS number, including other names
tert-Butyl 6-(benzyloxy)-3-formyl-1H-indole-1-carboxylate 95% (CAS 630110-71-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A196576-1g |
| cas | 630110-71-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 665.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A196576 |
Tert-butyl 3-formyl-6-phenylmethoxyindole-1-carboxylate (CAS 630110-71-3) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: tert-butyl 3-formyl-6-phenylmethoxyindole-1-carboxylate. InChIKey: BIGAKQBLDWFYEU-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | tert-butyl 3-formyl-6-phenylmethoxyindole-1-carboxylate |
| InChIKey | BIGAKQBLDWFYEU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=C(C=C2)OCC3=CC=CC=C3)C=O |
Computed by PubChem (NCBI)