CAS 219552-64-4 appears in our catalog under these names: tert–Butyl 6–nitro–1H–indole–1–carboxylate, 1-BOC-6-nitroindole, 97%, 97%, tert-Butyl 6-nitro-1H-indole-1-carboxylate, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 100mg.
Tert-butyl 6-nitroindole-1-carboxylate (CAS 219552-64-4) is a chemical compound with the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. IUPAC name: tert-butyl 6-nitroindole-1-carboxylate. InChIKey: MQRWVUYQAKQBPO-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O4 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | tert-butyl 6-nitroindole-1-carboxylate |
| InChIKey | MQRWVUYQAKQBPO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)