cas: 663172-80-3 — see every product listed under this CAS number, including other names
tert-Butyl 6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate 95% (CAS 663172-80-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A102155-100mg |
| cas | 663172-80-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 2378.44 Pln | |
| Ambeed | 5g | 8964.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A102155 |
Tert-butyl 6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate (CAS 663172-80-3) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: tert-butyl 6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate. InChIKey: SSFIFLZYPGAHGB-UHFFFAOYSA-N.
| Molecular formula | C11H17NO3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | tert-butyl 6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate |
| InChIKey | SSFIFLZYPGAHGB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(=O)C2C1 |
Computed by PubChem (NCBI)