cas: 663172-80-3 — see every product listed under this CAS number, including other names
tert-Butyl 6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate, 95% (CAS 663172-80-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F340147-100MG |
| cas | 663172-80-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 575.86 Pln | |
| Fluorochem | 250mg | 888.25 Pln | |
| Fluorochem | 1g | 3298.86 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate (CAS 663172-80-3) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: tert-butyl 6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate. InChIKey: SSFIFLZYPGAHGB-UHFFFAOYSA-N.
| Molecular formula | C11H17NO3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | tert-butyl 6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate |
| InChIKey | SSFIFLZYPGAHGB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(=O)C2C1 |
Computed by PubChem (NCBI)