cas: 873924-07-3 — see every product listed under this CAS number, including other names
tert-Butyl 9-oxo-3-azaspiro[5.5]undec-7-ene-3-carboxylate 97% (CAS 873924-07-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A219021-100mg |
| cas | 873924-07-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 587.31 Pln | |
| Ambeed | 1g | 1115.75 Pln | |
| Ambeed | 5g | 3212.81 Pln | |
| Ambeed | 10g | 5304.31 Pln | |
| Ambeed | 25g | 10544.19 Pln | |
| Ambeed | 100g | 33589.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A219021 |
Tert-butyl 9-oxo-3-azaspiro[5.5]undec-10-ene-3-carboxylate (CAS 873924-07-3) is a chemical compound with the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. IUPAC name: tert-butyl 9-oxo-3-azaspiro[5.5]undec-10-ene-3-carboxylate. InChIKey: QAHLORULIOPMFV-UHFFFAOYSA-N.
| Molecular formula | C15H23NO3 |
|---|---|
| Molecular weight | 265.35 g/mol |
| IUPAC name | tert-butyl 9-oxo-3-azaspiro[5.5]undec-10-ene-3-carboxylate |
| InChIKey | QAHLORULIOPMFV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(=O)C=C2)CC1 |
Computed by PubChem (NCBI)