cas: 132234-68-5 — see every product listed under this CAS number, including other names
tert-Butyl N-[(3-exo)-8-azabicyclo[3.2.1]octan-3-yl]carbamate 95% (CAS 132234-68-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1360347-250mg |
| cas | 132234-68-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1577.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1360347 |
Tert-butyl N-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]carbamate (CAS 132234-68-5) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl N-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]carbamate. InChIKey: UUHPKKKRSZBQIG-ULKQDVFKSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl N-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]carbamate |
| InChIKey | UUHPKKKRSZBQIG-ULKQDVFKSA-N |
| SMILES | CC(C)(C)OC(=O)NC1C[C@H]2CC[C@@H](C1)N2 |
Computed by PubChem (NCBI)