cas: 186203-81-6 — see every product listed under this CAS number, including other names
tert-Butyl hexahydro-1H-pyrrolo[3,4-b]pyridine-6(2H)-carboxylate 95% (cis) (CAS 186203-81-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A862625-50mg |
| cas | 186203-81-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 626.25 Pln | |
| Ambeed | 100mg | 743.06 Pln | |
| Ambeed | 250mg | 876.56 Pln | |
| Ambeed | 1g | 2267.19 Pln | |
| Ambeed | 5g | 7824.12 Pln |
| purity | 95% (cis) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A862625 |
Tert-butyl 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate (CAS 186203-81-6) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate. InChIKey: LPNOEYLQBVUWGH-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate |
| InChIKey | LPNOEYLQBVUWGH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCCNC2C1 |
Computed by PubChem (NCBI)