cas: 186203-81-6 — see every product listed under this CAS number, including other names
tert-Butyl hexahydro-1H-pyrrolo[3,4-b]pyridine-6(2H)-carboxylate (CAS 186203-81-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F234628-100MG |
| cas | 186203-81-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1127.75 Pln | |
| Fluorochem | 250mg | 2012.85 Pln | |
| Fluorochem | 1g | 5162.78 Pln | |
| Fluorochem | 5g | 14560.52 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate (CAS 186203-81-6) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate. InChIKey: LPNOEYLQBVUWGH-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate |
| InChIKey | LPNOEYLQBVUWGH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCCNC2C1 |
Computed by PubChem (NCBI)