cas: 169750-88-3 — see every product listed under this CAS number, including other names
tert-Butyl octahydro-1H-pyrrolo[2,3-c]pyridine-1-carboxylate, 95% (CAS 169750-88-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 500mg, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QE-5026-5g |
| cas | 169750-88-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 466.52 Pln | |
| Fluorochem | 250mg | 732.05 Pln | |
| Fluorochem | 500mg | 1414.10 Pln | |
| Fluorochem | 1g | 1757.73 Pln | |
| Fluorochem | 5g | 5391.87 Pln | |
| Fluorochem | 10g | 8562.63 Pln | |
| Fluorochem | 25g | 17070.05 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Tert-butyl 2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-1-carboxylate (CAS 169750-88-3) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-1-carboxylate. InChIKey: KFOSBANHALBORK-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-1-carboxylate |
| InChIKey | KFOSBANHALBORK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2C1CNCC2 |
Computed by PubChem (NCBI)