cas: 1279820-16-4 — see every product listed under this CAS number, including other names
tert-Butyl(2-chloropyrimidin-5-yl)methylcarbamate, 95%, 95% (CAS 1279820-16-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DHGD-50mg |
| cas | 1279820-16-4 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 822.80 Pln | |
| Chemat | 100mg | 1182.80 Pln | |
| Chemat | 250mg | 1773.20 Pln | |
| Chemat | 1g | 4730.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2-chloropyrimidin-5-yl)methyl]carbamate (CAS 1279820-16-4) is a chemical compound with the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. IUPAC name: tert-butyl N-[(2-chloropyrimidin-5-yl)methyl]carbamate. InChIKey: VUFBZTGHKQVWPB-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O2 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | tert-butyl N-[(2-chloropyrimidin-5-yl)methyl]carbamate |
| InChIKey | VUFBZTGHKQVWPB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CN=C(N=C1)Cl |
Computed by PubChem (NCBI)