cas: 1148048-37-6 — see every product listed under this CAS number, including other names
tert-butyl (1R,2R,5S)-2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate, 97% (CAS 1148048-37-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F874891-100MG |
| cas | 1148048-37-6 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1710.87 Pln | |
| Fluorochem | 250mg | 2543.91 Pln | |
| Fluorochem | 500mg | 3741.41 Pln | |
| Fluorochem | 1g | 6308.21 Pln | |
| Fluorochem | 5g | 21485.16 Pln | |
| Chemat | 100mg | 923.60 Pln | |
| Chemat | 250mg | 1360.40 Pln | |
| Chemat | 500mg | 2248.40 Pln | |
| Chemat | 1g | 3376.40 Pln | |
| Chemat | 5g | 13086.80 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Tert-butyl (1R,2R,5S)-2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate (CAS 1148048-37-6) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl (1R,2R,5S)-2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: SRRXFFKYXKCTOS-HLTSFMKQSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl (1R,2R,5S)-2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | SRRXFFKYXKCTOS-HLTSFMKQSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@H]2[C@@H]1CO |
Computed by PubChem (NCBI)