tert-butyl 2-benzyl-10-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate, 97%
cas: 1330764-01-6 — see every product listed under this CAS number, including other names
tert-butyl 2-benzyl-10-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate, 97% (CAS 1330764-01-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch112586-100mg |
| cas | 1330764-01-6 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 500mg | 1259.60 Pln | |
| Chemat | 1g | 1691.60 Pln | |
| Chemat | 5g | 7072.40 Pln | |
| Chemat | 10g | 11949.20 Pln | |
| Fluorochem | 100mg | 888.25 Pln | |
| Fluorochem | 250mg | 1273.53 Pln | |
| Fluorochem | 500mg | 2335.65 Pln | |
| Fluorochem | 1g | 3147.87 Pln | |
| Fluorochem | 5g | 12910.06 Pln | |
| Fluorochem | 10g | 21828.79 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-benzyl-10-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate (CAS 1330764-01-6) is a chemical compound with the molecular formula C20H28N2O3 and a molecular weight of 344.4 g/mol. IUPAC name: tert-butyl 2-benzyl-10-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate. InChIKey: XNXVCGUUXFLGCB-UHFFFAOYSA-N.
| Molecular formula | C20H28N2O3 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | tert-butyl 2-benzyl-10-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate |
| InChIKey | XNXVCGUUXFLGCB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C2(C1)CCN(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)