cas: 1820607-75-7 — see every product listed under this CAS number, including other names
tert-butyl 3-bromo-2-methoxybenzoate, 98%, 98% (CAS 1820607-75-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I1HK-100mg |
| cas | 1820607-75-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 654.80 Pln | |
| Chemat | 5g | 1835.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-bromo-2-methoxybenzoate (CAS 1820607-75-7) is a chemical compound with the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. IUPAC name: tert-butyl 3-bromo-2-methoxybenzoate. InChIKey: IMKRIMAABXIJMK-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO3 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | tert-butyl 3-bromo-2-methoxybenzoate |
| InChIKey | IMKRIMAABXIJMK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=CC=C1)Br)OC |
Computed by PubChem (NCBI)